C17H24N4O5 — CID 25210543
6-[[4-[(3,4-dihydroxy-5-methoxyphenyl)methylamino]butylamino]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 25210543) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 6-[[4-[(3,4-dihydroxy-5-methoxyphenyl)methylamino]butylamino]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[4-[(3,4-dihydroxy-5-methoxyphenyl)methylamino]butylamino]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25210543 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 6-[[4-[(3,4-dihydroxy-5-methoxyphenyl)methylamino]butylamino]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1cc(CNCCCCNCc2cc(=O)[nH]c(=O)[nH]2)cc(O)c1O |
| InChI | InChI=1S/C17H24N4O5/c1-26-14-7-11(6-13(22)16(14)24)9-18-4-2-3-5-19-10-12-8-15(23)21-17(25)20-12/h6-8,18-19,22,24H,2-5,9-10H2,1H3,(H2,20,21,23,25) |
| InChIKey | ZVEPINYPPSZTPC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|