C40H56CaN6O10 — CID 25210746
calcium bis((4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboximidate) (PubChem CID 25210746) has the molecular formula C40H56CaN6O10 and a molecular weight of 821.00 g/mol. Its IUPAC name is calcium bis((4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboximidate).
| Compound Name | calcium bis((4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboximidate) |
|---|---|
| PubChem CID | 25210746 |
| Molecular Formula | C40H56CaN6O10 |
| Molecular Weight | 821.00 g/mol |
| Exact Mass | 820.37 |
| IUPAC Name | calcium bis((4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboximidate) |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1COC[C@H]1/C([O-])=N/[C@@H](C)c1ccccc1.CCCC[C@H](CN(O)C=O)C(=O)N1COC[C@H]1/C([O-])=N\[C@@H](C)c1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C20H29N3O5.Ca/c2*1-3-4-8-17(11-22(27)13-24)20(26)23-14-28-12-18(23)19(25)21-15(2)16-9-6-5-7-10-16;/h2*5-7,9-10,13,15,17-18,27H,3-4,8,11-12,14H2,1-2H3,(H,21,25);/q;;+2/p-2/t2*15-,17+,18-;/m00./s1 |
| InChIKey | UEAIQQSSQAYFNT-BTTQUENPSA-L |
| XLogP | 2.31 |
| TPSA | 211.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.00 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|