C24H15F6N3O3 — CID 25210975
2-[3,5-bis(trifluoromethyl)phenyl]-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione (PubChem CID 25210975) has the molecular formula C24H15F6N3O3 and a molecular weight of 507.39 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 25210975 |
| Molecular Formula | C24H15F6N3O3 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C24H15F6N3O3/c1-32-20-17(21(35)33(2)22(32)36)15(16-18(31-20)13-5-3-4-6-14(13)19(16)34)10-7-11(23(25,26)27)9-12(8-10)24(28,29)30/h3-9,15,31H,1-2H3 |
| InChIKey | QFCBBYVKBMLBPB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |