About 1,4-dimethyl-2,5-di(propan-2-yl)benzene
1,4-dimethyl-2,5-di(propan-2-yl)benzene (PubChem CID 25211) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,4-dimethyl-2,5-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,5-di(propan-2-yl)benzene |
| PubChem CID | 25211 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,4-dimethyl-2,5-di(propan-2-yl)benzene |
| SMILES | Cc1cc(C(C)C)c(C)cc1C(C)C |
| InChI | InChI=1S/C14H22/c1-9(2)13-7-12(6)14(10(3)4)8-11(13)5/h7-10H,1-6H3 |
| InChIKey | MBEBPYJMHLBHDJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethyl-2,5-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,5-di(propan-2-yl)benzene?
The IUPAC name of 1,4-dimethyl-2,5-di(propan-2-yl)benzene (CID 25211) is 1,4-dimethyl-2,5-di(propan-2-yl)benzene.
What is the SMILES notation for 1,4-dimethyl-2,5-di(propan-2-yl)benzene?
The canonical SMILES for 1,4-dimethyl-2,5-di(propan-2-yl)benzene is Cc1cc(C(C)C)c(C)cc1C(C)C.
What is the InChIKey of 1,4-dimethyl-2,5-di(propan-2-yl)benzene?
The InChIKey is MBEBPYJMHLBHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-9(2)13-7-12(6)14(10(3)4)8-11(13)5/h7-10H,1-6H3.
What are the key properties of 1,4-dimethyl-2,5-di(propan-2-yl)benzene?
1,4-dimethyl-2,5-di(propan-2-yl)benzene has a molecular weight of 190.33 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,5-di(propan-2-yl)benzene is sourced from PubChem (CID 25211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).