C14H11NO2 — CID 25211163
(2R)-2-quinolin-3-yl-2,3-dihydropyran-6-one (PubChem CID 25211163) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2R)-2-quinolin-3-yl-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-quinolin-3-yl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 25211163 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2R)-2-quinolin-3-yl-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@H](c2cnc3ccccc3c2)O1 |
| InChI | InChI=1S/C14H11NO2/c16-14-7-3-6-13(17-14)11-8-10-4-1-2-5-12(10)15-9-11/h1-5,7-9,13H,6H2/t13-/m1/s1 |
| InChIKey | WGQDBTXDPAJOHV-CYBMUJFWSA-N |
| XLogP | 2.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |