C18H12N2O3S2 — CID 25211429
(5E)-5-[[4-[5-(hydroxymethyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211429) has the molecular formula C18H12N2O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (5E)-5-[[4-[5-(hydroxymethyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[5-(hydroxymethyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211429 |
| Molecular Formula | C18H12N2O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | (5E)-5-[[4-[5-(hydroxymethyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4ccc(CO)s4)c3c2)S1 |
| InChI | InChI=1S/C18H12N2O3S2/c21-9-11-2-4-15(24-11)12-5-6-19-14-3-1-10(7-13(12)14)8-16-17(22)20-18(23)25-16/h1-8,21H,9H2,(H,20,22,23)/b16-8+ |
| InChIKey | PQIIQJXXDXKREM-LZYBPNLTSA-N |
| XLogP | 3.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|