About 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole
4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole (PubChem CID 25211509) has the molecular formula C8H8F6N2S
and a molecular weight of 278.22 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole |
| PubChem CID | 25211509 |
| Molecular Formula | C8H8F6N2S |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole |
| SMILES | FC(F)(F)CCSCn1cnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H8F6N2S/c9-7(10,11)1-2-17-5-16-3-6(15-4-16)8(12,13)14/h3-4H,1-2,5H2 |
| InChIKey | AYEWMPJGFFUVAK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole?
The IUPAC name of 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole (CID 25211509) is 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole.
What is the SMILES notation for 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole?
The canonical SMILES for 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole is FC(F)(F)CCSCn1cnc(C(F)(F)F)c1.
What is the InChIKey of 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole?
The InChIKey is AYEWMPJGFFUVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F6N2S/c9-7(10,11)1-2-17-5-16-3-6(15-4-16)8(12,13)14/h3-4H,1-2,5H2.
What are the key properties of 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole?
4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole has a molecular weight of 278.22 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-1-(3,3,3-trifluoropropylsulfanylmethyl)imidazole is sourced from PubChem (CID 25211509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).