C22H15N3O3S2 — CID 25211544
(5E)-5-[[4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211544) has the molecular formula C22H15N3O3S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (5E)-5-[[4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211544 |
| Molecular Formula | C22H15N3O3S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | (5E)-5-[[4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1noc(C)c1-c1ccc(-c2ccnc3ccc(/C=C4/SC(=O)NC4=O)cc23)s1 |
| InChI | InChI=1S/C22H15N3O3S2/c1-11-20(12(2)28-25-11)18-6-5-17(29-18)14-7-8-23-16-4-3-13(9-15(14)16)10-19-21(26)24-22(27)30-19/h3-10H,1-2H3,(H,24,26,27)/b19-10+ |
| InChIKey | ZOBGSZRVUYKANO-VXLYETTFSA-N |
| XLogP | 5.56 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|