C18H10N2O4S2 — CID 25211546
5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophene-2-carboxylic acid (PubChem CID 25211546) has the molecular formula C18H10N2O4S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 25211546 |
| Molecular Formula | C18H10N2O4S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophene-2-carboxylic acid |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4ccc(C(=O)O)s4)c3c2)S1 |
| InChI | InChI=1S/C18H10N2O4S2/c21-16-15(26-18(24)20-16)8-9-1-2-12-11(7-9)10(5-6-19-12)13-3-4-14(25-13)17(22)23/h1-8H,(H,22,23)(H,20,21,24)/b15-8+ |
| InChIKey | LBGINCIHYUMBHN-OVCLIPMQSA-N |
| XLogP | 3.99 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|