C24H15N3O4S2 — CID 25211846
5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]-N-(4-hydroxyphenyl)thiophene-2-carboxamide (PubChem CID 25211846) has the molecular formula C24H15N3O4S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]-N-(4-hydroxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]-N-(4-hydroxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25211846 |
| Molecular Formula | C24H15N3O4S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 5-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]-N-(4-hydroxyphenyl)thiophene-2-carboxamide |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4ccc(C(=O)Nc5ccc(O)cc5)s4)c3c2)S1 |
| InChI | InChI=1S/C24H15N3O4S2/c28-15-4-2-14(3-5-15)26-22(29)20-8-7-19(32-20)16-9-10-25-18-6-1-13(11-17(16)18)12-21-23(30)27-24(31)33-21/h1-12,28H,(H,26,29)(H,27,30,31)/b21-12+ |
| InChIKey | WWSNTKHBLFMHAJ-CIAFOILYSA-N |
| XLogP | 5.25 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|