About [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate
[2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate (PubChem CID 25212002) has the molecular formula C10H10F6O5
and a molecular weight of 324.17 g/mol. Its IUPAC name is [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate |
| PubChem CID | 25212002 |
| Molecular Formula | C10H10F6O5 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O5/c1-5(2)7(18)20-3-6(17)21-4-8(19,9(11,12)13)10(14,15)16/h19H,1,3-4H2,2H3 |
| InChIKey | PBHDRCQXYRWSSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate?
The IUPAC name of [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate (CID 25212002) is [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate.
What is the SMILES notation for [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate?
The canonical SMILES for [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCC(=O)OCC(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate?
The InChIKey is PBHDRCQXYRWSSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F6O5/c1-5(2)7(18)20-3-6(17)21-4-8(19,9(11,12)13)10(14,15)16/h19H,1,3-4H2,2H3.
What are the key properties of [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate?
[2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate has a molecular weight of 324.17 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethyl] 2-methylprop-2-enoate is sourced from PubChem (CID 25212002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).