About 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine
7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine (PubChem CID 25212023) has the molecular formula C27H23N5O2
and a molecular weight of 449.51 g/mol. Its IUPAC name is 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine |
| PubChem CID | 25212023 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3c(-c4ccc5ccccc5c4)ccnc3n2C2CCNCC2)c1 |
| InChI | InChI=1S/C27H23N5O2/c33-32(34)23-7-3-6-21(17-23)26-30-25-24(20-9-8-18-4-1-2-5-19(18)16-20)12-15-29-27(25)31(26)22-10-13-28-14-11-22/h1-9,12,15-17,22,28H,10-11,13-14H2 |
| InChIKey | XEXGYBZJGZKJFZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine?
The IUPAC name of 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine (CID 25212023) is 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine.
What is the SMILES notation for 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine?
The canonical SMILES for 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine is O=[N+]([O-])c1cccc(-c2nc3c(-c4ccc5ccccc5c4)ccnc3n2C2CCNCC2)c1.
What is the InChIKey of 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine?
The InChIKey is XEXGYBZJGZKJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N5O2/c33-32(34)23-7-3-6-21(17-23)26-30-25-24(20-9-8-18-4-1-2-5-19(18)16-20)12-15-29-27(25)31(26)22-10-13-28-14-11-22/h1-9,12,15-17,22,28H,10-11,13-14H2.
What are the key properties of 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine?
7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine has a molecular weight of 449.51 g/mol, XLogP of 5.75, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-naphthalen-2-yl-2-(3-nitrophenyl)-3-piperidin-4-ylimidazo[4,5-b]pyridine is sourced from PubChem (CID 25212023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).