About 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine
2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine (PubChem CID 25212243) has the molecular formula C22H16FN3O5S
and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
| PubChem CID | 25212243 |
| Molecular Formula | C22H16FN3O5S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(-c4ccc(C5OCCCO5)cn4)sc23)c(F)c1 |
| InChI | InChI=1S/C22H16FN3O5S/c23-15-10-14(26(27)28)3-5-18(15)31-19-6-7-24-17-11-20(32-21(17)19)16-4-2-13(12-25-16)22-29-8-1-9-30-22/h2-7,10-12,22H,1,8-9H2 |
| InChIKey | QTTDOCZRNDCONI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine?
The IUPAC name of 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine (CID 25212243) is 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine.
What is the SMILES notation for 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine?
The canonical SMILES for 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine is O=[N+]([O-])c1ccc(Oc2ccnc3cc(-c4ccc(C5OCCCO5)cn4)sc23)c(F)c1.
What is the InChIKey of 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine?
The InChIKey is QTTDOCZRNDCONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O5S/c23-15-10-14(26(27)28)3-5-18(15)31-19-6-7-24-17-11-20(32-21(17)19)16-4-2-13(12-25-16)22-29-8-1-9-30-22/h2-7,10-12,22H,1,8-9H2.
What are the key properties of 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine?
2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine has a molecular weight of 453.45 g/mol, XLogP of 5.63, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,3-dioxan-2-yl)-2-pyridinyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine is sourced from PubChem (CID 25212243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).