C32H29F2N5O4S — CID 25212244
N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide (PubChem CID 25212244) has the molecular formula C32H29F2N5O4S and a molecular weight of 617.68 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide.
| Compound Name | N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 25212244 |
| Molecular Formula | C32H29F2N5O4S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)CC(=O)N(C)c5ccc(F)cc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C32H29F2N5O4S/c1-39(23-7-4-21(33)5-8-23)31(41)17-30(40)38-22-6-10-27(24(34)15-22)43-28-11-12-36-26-16-29(44-32(26)28)25-9-3-20(19-37-25)18-35-13-14-42-2/h3-12,15-16,19,35H,13-14,17-18H2,1-2H3,(H,38,40) |
| InChIKey | BXMNCZFPOFVYSI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|