C23H19FN2OS — CID 25212263
4-[(E)-2-[4-[5-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]aniline (PubChem CID 25212263) has the molecular formula C23H19FN2OS and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[(E)-2-[4-[5-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]aniline.
| Compound Name | 4-[(E)-2-[4-[5-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 25212263 |
| Molecular Formula | C23H19FN2OS |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(E)-2-[4-[5-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]aniline |
| SMILES | Nc1ccc(/C=C/c2ccc(-c3nc4cc(OCCF)ccc4s3)cc2)cc1 |
| InChI | InChI=1S/C23H19FN2OS/c24-13-14-27-20-11-12-22-21(15-20)26-23(28-22)18-7-3-16(4-8-18)1-2-17-5-9-19(25)10-6-17/h1-12,15H,13-14,25H2/b2-1+ |
| InChIKey | IYASHHUPHKSDBC-OWOJBTEDSA-N |
| XLogP | 6.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|