C17H22O4 — CID 25212663
5-[2-(2-ethylphenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 25212663) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-[2-(2-ethylphenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(2-ethylphenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 25212663 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-[2-(2-ethylphenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCc1ccccc1C(C)(C)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H22O4/c1-6-11-9-7-8-10-12(11)16(2,3)13-14(18)20-17(4,5)21-15(13)19/h7-10,13H,6H2,1-5H3 |
| InChIKey | PYJNSIYRZSLMAN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|