About tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate
tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate (PubChem CID 25212673) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate |
| PubChem CID | 25212673 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCNCC2 |
| InChI | InChI=1S/C14H26N2O2/c1-13(2,3)18-12(17)16-11-5-4-6-14(16)7-9-15-10-8-14/h15H,4-11H2,1-3H3 |
| InChIKey | HIKNQHIQQLZTQF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate?
The IUPAC name of tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate (CID 25212673) is tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate.
What is the SMILES notation for tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate?
The canonical SMILES for tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate is CC(C)(C)OC(=O)N1CCCCC12CCNCC2.
What is the InChIKey of tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate?
The InChIKey is HIKNQHIQQLZTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-13(2,3)18-12(17)16-11-5-4-6-14(16)7-9-15-10-8-14/h15H,4-11H2,1-3H3.
What are the key properties of tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate?
tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate has a molecular weight of 254.37 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate is sourced from PubChem (CID 25212673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).