About CID 25212690
CID 25212690 (PubChem CID 25212690) has the molecular formula C9H6BrClInS
and a molecular weight of 376.39 g/mol.
Molecular Properties
| Compound Name | CID 25212690 |
| PubChem CID | 25212690 |
| Molecular Formula | C9H6BrClInS |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 374.81 |
| IUPAC Name | — |
| SMILES | Clc1ccc2scc(C[In]Br)c2c1 |
| InChI | InChI=1S/C9H6ClS.BrH.In/c1-6-5-11-9-3-2-7(10)4-8(6)9;;/h2-5H,1H2;1H;/q;;+1/p-1 |
| InChIKey | NEBSHDSOPDJKHM-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 25212690 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25212690?
The IUPAC name of CID 25212690 (CID 25212690) is not available.
What is the SMILES notation for CID 25212690?
The canonical SMILES for CID 25212690 is Clc1ccc2scc(C[In]Br)c2c1.
What is the InChIKey of CID 25212690?
The InChIKey is NEBSHDSOPDJKHM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6ClS.BrH.In/c1-6-5-11-9-3-2-7(10)4-8(6)9;;/h2-5H,1H2;1H;/q;;+1/p-1.
What are the key properties of CID 25212690?
CID 25212690 has a molecular weight of 376.39 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25212690 is sourced from PubChem (CID 25212690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).