About [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol
[(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 25212903) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 25212903 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | CC(C)CC1=NO[C@H](CO)C1 |
| InChI | InChI=1S/C8H15NO2/c1-6(2)3-7-4-8(5-10)11-9-7/h6,8,10H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | HLKUMJVRFJTVSO-QMMMGPOBSA-N |
| XLogP | 1.17 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (CID 25212903) is [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is CC(C)CC1=NO[C@H](CO)C1.
What is the InChIKey of [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is HLKUMJVRFJTVSO-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(2)3-7-4-8(5-10)11-9-7/h6,8,10H,3-5H2,1-2H3/t8-/m0/s1.
What are the key properties of [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
[(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 157.21 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-3-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 25212903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).