C15H17FO4 — CID 25212921
5-[2-(2-fluorophenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 25212921) has the molecular formula C15H17FO4 and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-[2-(2-fluorophenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(2-fluorophenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 25212921 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[2-(2-fluorophenyl)propan-2-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(C)(C)c2ccccc2F)C(=O)O1 |
| InChI | InChI=1S/C15H17FO4/c1-14(2,9-7-5-6-8-10(9)16)11-12(17)19-15(3,4)20-13(11)18/h5-8,11H,1-4H3 |
| InChIKey | QUSSCODFUNQKPC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|