About 1-benzyl-1,9-diazaspiro[5.5]undecane
1-benzyl-1,9-diazaspiro[5.5]undecane (PubChem CID 25212931) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-benzyl-1,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 1-benzyl-1,9-diazaspiro[5.5]undecane |
| PubChem CID | 25212931 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-benzyl-1,9-diazaspiro[5.5]undecane |
| SMILES | c1ccc(CN2CCCCC23CCNCC3)cc1 |
| InChI | InChI=1S/C16H24N2/c1-2-6-15(7-3-1)14-18-13-5-4-8-16(18)9-11-17-12-10-16/h1-3,6-7,17H,4-5,8-14H2 |
| InChIKey | QKKQOABRVDBFKQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-1,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,9-diazaspiro[5.5]undecane?
The IUPAC name of 1-benzyl-1,9-diazaspiro[5.5]undecane (CID 25212931) is 1-benzyl-1,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 1-benzyl-1,9-diazaspiro[5.5]undecane?
The canonical SMILES for 1-benzyl-1,9-diazaspiro[5.5]undecane is c1ccc(CN2CCCCC23CCNCC3)cc1.
What is the InChIKey of 1-benzyl-1,9-diazaspiro[5.5]undecane?
The InChIKey is QKKQOABRVDBFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-2-6-15(7-3-1)14-18-13-5-4-8-16(18)9-11-17-12-10-16/h1-3,6-7,17H,4-5,8-14H2.
What are the key properties of 1-benzyl-1,9-diazaspiro[5.5]undecane?
1-benzyl-1,9-diazaspiro[5.5]undecane has a molecular weight of 244.38 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 25212931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).