C18H21FO4 — CID 25213164
5-[1-(2-fluorophenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 25213164) has the molecular formula C18H21FO4 and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-[1-(2-fluorophenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-(2-fluorophenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 25213164 |
| Molecular Formula | C18H21FO4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5-[1-(2-fluorophenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C2(c3ccccc3F)CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C18H21FO4/c1-17(2)22-15(20)14(16(21)23-17)18(10-6-3-7-11-18)12-8-4-5-9-13(12)19/h4-5,8-9,14H,3,6-7,10-11H2,1-2H3 |
| InChIKey | GTHDKXGWCSIMGB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|