C23H42O4Si — CID 25213182
(3E,5R,8S,9E,13S,14R)-8-hydroxy-5,9,13,14-tetramethyl-5-triethylsilyloxy-1-oxacyclotetradeca-3,9-dien-2-one (PubChem CID 25213182) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is (3E,5R,8S,9E,13S,14R)-8-hydroxy-5,9,13,14-tetramethyl-5-triethylsilyloxy-1-oxacyclotetradeca-3,9-dien-2-one.
| Compound Name | (3E,5R,8S,9E,13S,14R)-8-hydroxy-5,9,13,14-tetramethyl-5-triethylsilyloxy-1-oxacyclotetradeca-3,9-dien-2-one |
|---|---|
| PubChem CID | 25213182 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (3E,5R,8S,9E,13S,14R)-8-hydroxy-5,9,13,14-tetramethyl-5-triethylsilyloxy-1-oxacyclotetradeca-3,9-dien-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)/C=C/C(=O)O[C@H](C)[C@@H](C)CC/C=C(\C)[C@@H](O)CC1 |
| InChI | InChI=1S/C23H42O4Si/c1-8-28(9-2,10-3)27-23(7)16-14-21(24)19(5)13-11-12-18(4)20(6)26-22(25)15-17-23/h13,15,17-18,20-21,24H,8-12,14,16H2,1-7H3/b17-15+,19-13+/t18-,20+,21-,23+/m0/s1 |
| InChIKey | RKPHATPBYVVNBT-OZJFHOGKSA-N |
| XLogP | 5.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|