C24H22F2N6O — CID 25213310
8-(3,4-difluorophenyl)-2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 25213310) has the molecular formula C24H22F2N6O and a molecular weight of 448.48 g/mol. Its IUPAC name is 8-(3,4-difluorophenyl)-2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(3,4-difluorophenyl)-2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 25213310 |
| Molecular Formula | C24H22F2N6O |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 8-(3,4-difluorophenyl)-2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCCC3c2ccc(F)c(F)c2)cnc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H22F2N6O/c1-15-13-31(14-28-15)24-21(33-2)10-16(12-27-24)5-8-22-29-23-18(4-3-9-32(23)30-22)17-6-7-19(25)20(26)11-17/h5-8,10-14,18H,3-4,9H2,1-2H3/b8-5+ |
| InChIKey | LAYKCYRBEORVKK-VMPITWQZSA-N |
| XLogP | 4.55 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |