C25H20F3N7O — CID 25213311
2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 25213311) has the molecular formula C25H20F3N7O and a molecular weight of 491.48 g/mol. Its IUPAC name is 2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | 2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 25213311 |
| Molecular Formula | C25H20F3N7O |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[(E)-2-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCCC3(C#N)c2cc(F)c(F)c(F)c2)cnc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H20F3N7O/c1-15-12-34(14-31-15)23-20(36-2)8-16(11-30-23)4-5-21-32-24-25(13-29,6-3-7-35(24)33-21)17-9-18(26)22(28)19(27)10-17/h4-5,8-12,14H,3,6-7H2,1-2H3/b5-4+ |
| InChIKey | BHUCRVYVUFCXRC-SNAWJCMRSA-N |
| XLogP | 4.37 |
| TPSA | 94.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|