C26H50O5Si — CID 25213351
methyl (2Z,4E,6R,9S)-10-(1-ethoxyethoxy)-3,9-dimethyl-6-tri(propan-2-yl)silyloxydeca-2,4-dienoate (PubChem CID 25213351) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is methyl (2Z,4E,6R,9S)-10-(1-ethoxyethoxy)-3,9-dimethyl-6-tri(propan-2-yl)silyloxydeca-2,4-dienoate.
| Compound Name | methyl (2Z,4E,6R,9S)-10-(1-ethoxyethoxy)-3,9-dimethyl-6-tri(propan-2-yl)silyloxydeca-2,4-dienoate |
|---|---|
| PubChem CID | 25213351 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | methyl (2Z,4E,6R,9S)-10-(1-ethoxyethoxy)-3,9-dimethyl-6-tri(propan-2-yl)silyloxydeca-2,4-dienoate |
| SMILES | CCOC(C)OC[C@@H](C)CC[C@H](/C=C/C(C)=C\C(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H50O5Si/c1-12-29-24(10)30-18-23(9)14-16-25(15-13-22(8)17-26(27)28-11)31-32(19(2)3,20(4)5)21(6)7/h13,15,17,19-21,23-25H,12,14,16,18H2,1-11H3/b15-13+,22-17-/t23-,24?,25-/m0/s1 |
| InChIKey | MPGWMPBENFBCEU-ZUTMSDKOSA-N |
| XLogP | 7.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|