C30H57O7PSi — CID 25213816
[(2R,3S)-3,7-dimethyloct-6-en-2-yl] (E,4R)-8-diethoxyphosphoryl-4-methyl-7-oxo-4-triethylsilyloxynon-2-enoate (PubChem CID 25213816) has the molecular formula C30H57O7PSi and a molecular weight of 588.84 g/mol. Its IUPAC name is [(2R,3S)-3,7-dimethyloct-6-en-2-yl] (E,4R)-8-diethoxyphosphoryl-4-methyl-7-oxo-4-triethylsilyloxynon-2-enoate.
| Compound Name | [(2R,3S)-3,7-dimethyloct-6-en-2-yl] (E,4R)-8-diethoxyphosphoryl-4-methyl-7-oxo-4-triethylsilyloxynon-2-enoate |
|---|---|
| PubChem CID | 25213816 |
| Molecular Formula | C30H57O7PSi |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [(2R,3S)-3,7-dimethyloct-6-en-2-yl] (E,4R)-8-diethoxyphosphoryl-4-methyl-7-oxo-4-triethylsilyloxynon-2-enoate |
| SMILES | CCOP(=O)(OCC)C(C)C(=O)CC[C@](C)(/C=C/C(=O)O[C@H](C)[C@@H](C)CCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H57O7PSi/c1-12-34-38(33,35-13-2)27(10)28(31)20-22-30(11,37-39(14-3,15-4)16-5)23-21-29(32)36-26(9)25(8)19-17-18-24(6)7/h18,21,23,25-27H,12-17,19-20,22H2,1-11H3/b23-21+/t25-,26+,27?,30+/m0/s1 |
| InChIKey | GYDWUZWRYNROCP-HZCDUUKISA-N |
| XLogP | 8.64 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|