About (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide
(2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide (PubChem CID 25214611) has the molecular formula C12H22ClO3P
and a molecular weight of 280.73 g/mol. Its IUPAC name is (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide.
Molecular Properties
| Compound Name | (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide |
| PubChem CID | 25214611 |
| Molecular Formula | C12H22ClO3P |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide |
| SMILES | CCCCC1=C(Cl)[C@](C)(CC)O[P@]1(=O)OCC |
| InChI | InChI=1S/C12H22ClO3P/c1-5-8-9-10-11(13)12(4,6-2)16-17(10,14)15-7-3/h5-9H2,1-4H3/t12-,17+/m0/s1 |
| InChIKey | DIMRFOZLQYAMOU-YVEFUNNKSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide?
The IUPAC name of (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide (CID 25214611) is (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide.
What is the SMILES notation for (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide?
The canonical SMILES for (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide is CCCCC1=C(Cl)[C@](C)(CC)O[P@]1(=O)OCC.
What is the InChIKey of (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide?
The InChIKey is DIMRFOZLQYAMOU-YVEFUNNKSA-N. The full InChI is InChI=1S/C12H22ClO3P/c1-5-8-9-10-11(13)12(4,6-2)16-17(10,14)15-7-3/h5-9H2,1-4H3/t12-,17+/m0/s1.
What are the key properties of (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide?
(2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide has a molecular weight of 280.73 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-3-butyl-4-chloro-2-ethoxy-5-ethyl-5-methyl-1,2λ5-oxaphosphole 2-oxide is sourced from PubChem (CID 25214611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).