C18H23NO5 — CID 25214673
methyl (2R,4S)-5-[(3aS,9bR)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-2,4-dimethyl-5-oxopentanoate (PubChem CID 25214673) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (2R,4S)-5-[(3aS,9bR)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-2,4-dimethyl-5-oxopentanoate.
| Compound Name | methyl (2R,4S)-5-[(3aS,9bR)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-2,4-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 25214673 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (2R,4S)-5-[(3aS,9bR)-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazol-1-yl]-2,4-dimethyl-5-oxopentanoate |
| SMILES | COC(=O)[C@H](C)C[C@H](C)C(=O)N1OC[C@@H]2COc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C18H23NO5/c1-11(8-12(2)18(21)22-3)17(20)19-16-13(10-24-19)9-23-15-7-5-4-6-14(15)16/h4-7,11-13,16H,8-10H2,1-3H3/t11-,12+,13-,16+/m0/s1 |
| InChIKey | OAWXFEKLJCLDIL-RSUWNVLCSA-N |
| XLogP | 2.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |