C14H27O3P — CID 25215346
6-diethoxyphosphoryldeca-4,5-diene (PubChem CID 25215346) has the molecular formula C14H27O3P and a molecular weight of 274.34 g/mol. Its IUPAC name is 6-diethoxyphosphoryldeca-4,5-diene.
| Compound Name | 6-diethoxyphosphoryldeca-4,5-diene |
|---|---|
| PubChem CID | 25215346 |
| Molecular Formula | C14H27O3P |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 6-diethoxyphosphoryldeca-4,5-diene |
| SMILES | CCCC=C=C(CCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H27O3P/c1-5-9-11-13-14(12-10-6-2)18(15,16-7-3)17-8-4/h11H,5-10,12H2,1-4H3 |
| InChIKey | OOCQOXYIOVSDOV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|