About 3-diethoxyphosphorylhexa-1,2,5-triene
3-diethoxyphosphorylhexa-1,2,5-triene (PubChem CID 25215347) has the molecular formula C10H17O3P
and a molecular weight of 216.22 g/mol. Its IUPAC name is 3-diethoxyphosphorylhexa-1,2,5-triene.
Molecular Properties
| Compound Name | 3-diethoxyphosphorylhexa-1,2,5-triene |
| PubChem CID | 25215347 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-diethoxyphosphorylhexa-1,2,5-triene |
| SMILES | C=C=C(CC=C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H17O3P/c1-5-9-10(6-2)14(11,12-7-3)13-8-4/h5H,1-2,7-9H2,3-4H3 |
| InChIKey | KEMIZWYGMFIPSV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphorylhexa-1,2,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphorylhexa-1,2,5-triene?
The IUPAC name of 3-diethoxyphosphorylhexa-1,2,5-triene (CID 25215347) is 3-diethoxyphosphorylhexa-1,2,5-triene.
What is the SMILES notation for 3-diethoxyphosphorylhexa-1,2,5-triene?
The canonical SMILES for 3-diethoxyphosphorylhexa-1,2,5-triene is C=C=C(CC=C)P(=O)(OCC)OCC.
What is the InChIKey of 3-diethoxyphosphorylhexa-1,2,5-triene?
The InChIKey is KEMIZWYGMFIPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O3P/c1-5-9-10(6-2)14(11,12-7-3)13-8-4/h5H,1-2,7-9H2,3-4H3.
What are the key properties of 3-diethoxyphosphorylhexa-1,2,5-triene?
3-diethoxyphosphorylhexa-1,2,5-triene has a molecular weight of 216.22 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphorylhexa-1,2,5-triene is sourced from PubChem (CID 25215347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).