About 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole
2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole (PubChem CID 25215390) has the molecular formula C11H9BrClF2N
and a molecular weight of 308.55 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole |
| PubChem CID | 25215390 |
| Molecular Formula | C11H9BrClF2N |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole |
| SMILES | FC1(F)CC(CBr)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9BrClF2N/c12-6-9-5-11(14,15)10(16-9)7-1-3-8(13)4-2-7/h1-4,9H,5-6H2 |
| InChIKey | DAWDFUQYFXTTLS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole?
The IUPAC name of 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole (CID 25215390) is 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole.
What is the SMILES notation for 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole?
The canonical SMILES for 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole is FC1(F)CC(CBr)N=C1c1ccc(Cl)cc1.
What is the InChIKey of 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole?
The InChIKey is DAWDFUQYFXTTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrClF2N/c12-6-9-5-11(14,15)10(16-9)7-1-3-8(13)4-2-7/h1-4,9H,5-6H2.
What are the key properties of 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole?
2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole has a molecular weight of 308.55 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-5-(4-chlorophenyl)-4,4-difluoro-2,3-dihydropyrrole is sourced from PubChem (CID 25215390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).