C20H28O2 — CID 25215560
(6S)-6-[(1R,4S)-6-hydroxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-methylhept-1-en-3-one (PubChem CID 25215560) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (6S)-6-[(1R,4S)-6-hydroxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-methylhept-1-en-3-one.
| Compound Name | (6S)-6-[(1R,4S)-6-hydroxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-methylhept-1-en-3-one |
|---|---|
| PubChem CID | 25215560 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (6S)-6-[(1R,4S)-6-hydroxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-methylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CC[C@H](C)[C@H]1CC[C@H](C)c2cc(O)c(C)cc21 |
| InChI | InChI=1S/C20H28O2/c1-12(2)19(21)9-7-13(3)16-8-6-14(4)17-11-20(22)15(5)10-18(16)17/h10-11,13-14,16,22H,1,6-9H2,2-5H3/t13-,14-,16+/m0/s1 |
| InChIKey | BYQJYMGWLBSQCY-OFQRWUPVSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|