C22H30O4 — CID 25215561
[(1S,3S,3aR,6S,6aR,10aS)-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-7,10-dioxo-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[j]naphthalen-8-yl] acetate (PubChem CID 25215561) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1S,3S,3aR,6S,6aR,10aS)-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-7,10-dioxo-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[j]naphthalen-8-yl] acetate.
| Compound Name | [(1S,3S,3aR,6S,6aR,10aS)-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-7,10-dioxo-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[j]naphthalen-8-yl] acetate |
|---|---|
| PubChem CID | 25215561 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1S,3S,3aR,6S,6aR,10aS)-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-7,10-dioxo-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[j]naphthalen-8-yl] acetate |
| SMILES | CC(=O)OC1=C(C)C(=O)[C@]23[C@H](C=C(C)C)C[C@H](C)[C@H]2CC[C@H](C)[C@H]3C1=O |
| InChI | InChI=1S/C22H30O4/c1-11(2)9-16-10-13(4)17-8-7-12(3)18-19(24)20(26-15(6)23)14(5)21(25)22(16,17)18/h9,12-13,16-18H,7-8,10H2,1-6H3/t12-,13-,16+,17+,18-,22+/m0/s1 |
| InChIKey | WDOBQQCCJAKODE-UPMQHEDOSA-N |
| XLogP | 4.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|