C18H28O3 — CID 25215563
(1S,3S,3aR,5R,7aR)-5-hydroxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-3a-propanoyl-1,2,3,6,7,7a-hexahydroinden-4-one (PubChem CID 25215563) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1S,3S,3aR,5R,7aR)-5-hydroxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-3a-propanoyl-1,2,3,6,7,7a-hexahydroinden-4-one.
| Compound Name | (1S,3S,3aR,5R,7aR)-5-hydroxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-3a-propanoyl-1,2,3,6,7,7a-hexahydroinden-4-one |
|---|---|
| PubChem CID | 25215563 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (1S,3S,3aR,5R,7aR)-5-hydroxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-3a-propanoyl-1,2,3,6,7,7a-hexahydroinden-4-one |
| SMILES | CCC(=O)[C@@]12C(=O)[C@](C)(O)CC[C@@H]1[C@@H](C)C[C@H]2C=C(C)C |
| InChI | InChI=1S/C18H28O3/c1-6-15(19)18-13(9-11(2)3)10-12(4)14(18)7-8-17(5,21)16(18)20/h9,12-14,21H,6-8,10H2,1-5H3/t12-,13+,14+,17+,18-/m0/s1 |
| InChIKey | OVJQXJFASKBALI-HFGWPOCOSA-N |
| XLogP | 3.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|