C10H16F5N — CID 25215699
(E)-8,8,9,9,9-pentafluoro-N-methylnon-4-en-1-amine (PubChem CID 25215699) has the molecular formula C10H16F5N and a molecular weight of 245.23 g/mol. Its IUPAC name is (E)-8,8,9,9,9-pentafluoro-N-methylnon-4-en-1-amine.
| Compound Name | (E)-8,8,9,9,9-pentafluoro-N-methylnon-4-en-1-amine |
|---|---|
| PubChem CID | 25215699 |
| Molecular Formula | C10H16F5N |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (E)-8,8,9,9,9-pentafluoro-N-methylnon-4-en-1-amine |
| SMILES | CNCCC/C=C/CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16F5N/c1-16-8-6-4-2-3-5-7-9(11,12)10(13,14)15/h2-3,16H,4-8H2,1H3/b3-2+ |
| InChIKey | ZGKJKUWTLBHMQL-NSCUHMNNSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|