About N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide
N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide (PubChem CID 25215846) has the molecular formula C24H20N2O3
and a molecular weight of 384.44 g/mol. Its IUPAC name is N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide.
Molecular Properties
| Compound Name | N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide |
| PubChem CID | 25215846 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide |
| SMILES | COc1ccc(C(=O)N(c2ccccc2)c2nccc3ccccc23)cc1OC |
| InChI | InChI=1S/C24H20N2O3/c1-28-21-13-12-18(16-22(21)29-2)24(27)26(19-9-4-3-5-10-19)23-20-11-7-6-8-17(20)14-15-25-23/h3-16H,1-2H3 |
| InChIKey | BSIMXFAUKMYHNC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide?
The IUPAC name of N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide (CID 25215846) is N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide.
What is the SMILES notation for N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide?
The canonical SMILES for N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide is COc1ccc(C(=O)N(c2ccccc2)c2nccc3ccccc23)cc1OC.
What is the InChIKey of N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide?
The InChIKey is BSIMXFAUKMYHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O3/c1-28-21-13-12-18(16-22(21)29-2)24(27)26(19-9-4-3-5-10-19)23-20-11-7-6-8-17(20)14-15-25-23/h3-16H,1-2H3.
What are the key properties of N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide?
N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide has a molecular weight of 384.44 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-1-yl-3,4-dimethoxy-N-phenylbenzamide is sourced from PubChem (CID 25215846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).