C9H13F5O — CID 25215934
(E)-8,8,9,9,9-pentafluoronon-4-en-1-ol (PubChem CID 25215934) has the molecular formula C9H13F5O and a molecular weight of 232.19 g/mol. Its IUPAC name is (E)-8,8,9,9,9-pentafluoronon-4-en-1-ol.
| Compound Name | (E)-8,8,9,9,9-pentafluoronon-4-en-1-ol |
|---|---|
| PubChem CID | 25215934 |
| Molecular Formula | C9H13F5O |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (E)-8,8,9,9,9-pentafluoronon-4-en-1-ol |
| SMILES | OCCC/C=C/CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O/c10-8(11,9(12,13)14)6-4-2-1-3-5-7-15/h1-2,15H,3-7H2/b2-1+ |
| InChIKey | CPTHXGKXEIPCST-OWOJBTEDSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|