C16H19F5O3S — CID 25215936
[(E)-8,8,9,9,9-pentafluoronon-4-enyl] 4-methylbenzenesulfonate (PubChem CID 25215936) has the molecular formula C16H19F5O3S and a molecular weight of 386.38 g/mol. Its IUPAC name is [(E)-8,8,9,9,9-pentafluoronon-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-8,8,9,9,9-pentafluoronon-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 25215936 |
| Molecular Formula | C16H19F5O3S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(E)-8,8,9,9,9-pentafluoronon-4-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC/C=C/CCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F5O3S/c1-13-7-9-14(10-8-13)25(22,23)24-12-6-4-2-3-5-11-15(17,18)16(19,20)21/h2-3,7-10H,4-6,11-12H2,1H3/b3-2+ |
| InChIKey | BEZXIOXQCJWEEK-NSCUHMNNSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|