C21H21ClN4OS — CID 25216238
5-[2-[4-(1,2-benzothiazol-3-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 25216238) has the molecular formula C21H21ClN4OS and a molecular weight of 420.99 g/mol. Its IUPAC name is 5-[2-[4-(1,2-benzothiazol-3-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[4-(1,2-benzothiazol-3-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 25216238 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-[2-[4-(1,2-benzothiazol-3-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | [2H]C1([2H])N(CCc2cc3c(cc2Cl)NC(=O)C3)C([2H])([2H])C([2H])([2H])N(c2nsc3ccccc23)C1([2H])[2H] |
| InChI | InChI=1S/C21H21ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13H,5-10,12H2,(H,23,27)/i7D2,8D2,9D2,10D2 |
| InChIKey | MVWVFYHBGMAFLY-UFBJYANTSA-N |
| XLogP | 3.81 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |