About methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate
methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate (PubChem CID 25216257) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate.
Molecular Properties
| Compound Name | methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate |
| PubChem CID | 25216257 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-11-6(10)4-5(8)7-9-2-3-12-7/h2-3,5H,4,8H2,1H3/t5-/m1/s1 |
| InChIKey | HDBZHSVAXIFWSH-RXMQYKEDSA-N |
| XLogP | 0.71 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate?
The IUPAC name of methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate (CID 25216257) is methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate.
What is the SMILES notation for methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate?
The canonical SMILES for methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate is COC(=O)C[C@@H](N)c1nccs1.
What is the InChIKey of methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate?
The InChIKey is HDBZHSVAXIFWSH-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-11-6(10)4-5(8)7-9-2-3-12-7/h2-3,5H,4,8H2,1H3/t5-/m1/s1.
What are the key properties of methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate?
methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate has a molecular weight of 186.24 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-amino-3-(1,3-thiazol-2-yl)propanoate is sourced from PubChem (CID 25216257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).