C36H33F9N4O5 — CID 25216510
4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-morpholin-4-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]amino]pyrimidin-5-yl]oxybutanoic acid (PubChem CID 25216510) has the molecular formula C36H33F9N4O5 and a molecular weight of 772.66 g/mol. Its IUPAC name is 4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-morpholin-4-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]amino]pyrimidin-5-yl]oxybutanoic acid.
| Compound Name | 4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-morpholin-4-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]amino]pyrimidin-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 25216510 |
| Molecular Formula | C36H33F9N4O5 |
| Molecular Weight | 772.66 g/mol |
| Exact Mass | 772.23 |
| IUPAC Name | 4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-morpholin-4-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]amino]pyrimidin-5-yl]oxybutanoic acid |
| SMILES | COc1ccc(N2CCOCC2)cc1-c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ncc(OCCCC(=O)O)cn1 |
| InChI | InChI=1S/C36H33F9N4O5/c1-52-31-7-5-27(48-8-11-53-12-9-48)17-30(31)29-6-4-24(34(37,38)39)15-23(29)21-49(33-46-18-28(19-47-33)54-10-2-3-32(50)51)20-22-13-25(35(40,41)42)16-26(14-22)36(43,44)45/h4-7,13-19H,2-3,8-12,20-21H2,1H3,(H,50,51) |
| InChIKey | KQFVXFOBOWTPJT-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.66 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|