C24H16ClF2N3O3 — CID 25216517
6-chloro-2-[(15-ethyl-9-oxo-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-11-yl)methyl]-3,4-difluorobenzamide (PubChem CID 25216517) has the molecular formula C24H16ClF2N3O3 and a molecular weight of 467.86 g/mol. Its IUPAC name is 6-chloro-2-[(15-ethyl-9-oxo-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-11-yl)methyl]-3,4-difluorobenzamide.
| Compound Name | 6-chloro-2-[(15-ethyl-9-oxo-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-11-yl)methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 25216517 |
| Molecular Formula | C24H16ClF2N3O3 |
| Molecular Weight | 467.86 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 6-chloro-2-[(15-ethyl-9-oxo-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-11-yl)methyl]-3,4-difluorobenzamide |
| SMILES | CCc1ccc2c(c1)c1c3cccnc3oc(=O)c1n2Cc1c(F)c(F)cc(Cl)c1C(N)=O |
| InChI | InChI=1S/C24H16ClF2N3O3/c1-2-11-5-6-17-13(8-11)18-12-4-3-7-29-23(12)33-24(32)21(18)30(17)10-14-19(22(28)31)15(25)9-16(26)20(14)27/h3-9H,2,10H2,1H3,(H2,28,31) |
| InChIKey | NCUMEOJLMOXWJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|