C22H11F4N3O4 — CID 25216519
11-[(2-fluoro-5-nitrophenyl)methyl]-15-(trifluoromethyl)-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one (PubChem CID 25216519) has the molecular formula C22H11F4N3O4 and a molecular weight of 457.34 g/mol. Its IUPAC name is 11-[(2-fluoro-5-nitrophenyl)methyl]-15-(trifluoromethyl)-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one.
| Compound Name | 11-[(2-fluoro-5-nitrophenyl)methyl]-15-(trifluoromethyl)-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
|---|---|
| PubChem CID | 25216519 |
| Molecular Formula | C22H11F4N3O4 |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 11-[(2-fluoro-5-nitrophenyl)methyl]-15-(trifluoromethyl)-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
| SMILES | O=c1oc2ncccc2c2c3cc(C(F)(F)F)ccc3n(Cc3cc([N+](=O)[O-])ccc3F)c12 |
| InChI | InChI=1S/C22H11F4N3O4/c23-16-5-4-13(29(31)32)8-11(16)10-28-17-6-3-12(22(24,25)26)9-15(17)18-14-2-1-7-27-20(14)33-21(30)19(18)28/h1-9H,10H2 |
| InChIKey | FSPMNRUWFZVRMQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|