C25H20Cl2F3N3O2 — CID 25216767
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N',2-dimethyl-N'-phenylbenzohydrazide (PubChem CID 25216767) has the molecular formula C25H20Cl2F3N3O2 and a molecular weight of 522.35 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N',2-dimethyl-N'-phenylbenzohydrazide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N',2-dimethyl-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 25216767 |
| Molecular Formula | C25H20Cl2F3N3O2 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N',2-dimethyl-N'-phenylbenzohydrazide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NN(C)c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2F3N3O2/c1-15-10-16(8-9-21(15)23(34)31-33(2)20-6-4-3-5-7-20)22-14-24(35-32-22,25(28,29)30)17-11-18(26)13-19(27)12-17/h3-13H,14H2,1-2H3,(H,31,34) |
| InChIKey | BUSYZRSTDLGCPA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|