C25H30N4O2 — CID 25217000
tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-3-yl]methyl]carbamate (PubChem CID 25217000) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 25217000 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(c2nccc(-c3ccc4ccccc4c3)n2)C1 |
| InChI | InChI=1S/C25H30N4O2/c1-25(2,3)31-24(30)27-16-18-7-6-14-29(17-18)23-26-13-12-22(28-23)21-11-10-19-8-4-5-9-20(19)15-21/h4-5,8-13,15,18H,6-7,14,16-17H2,1-3H3,(H,27,30) |
| InChIKey | OOHMTFWRZMGSAE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |