C25H16ClF2N3O3 — CID 25217446
5-[4-[(5-chloro-2-pyridinyl)amino]benzoyl]-2-(3,4-difluoroanilino)benzoic acid (PubChem CID 25217446) has the molecular formula C25H16ClF2N3O3 and a molecular weight of 479.87 g/mol. Its IUPAC name is 5-[4-[(5-chloro-2-pyridinyl)amino]benzoyl]-2-(3,4-difluoroanilino)benzoic acid.
| Compound Name | 5-[4-[(5-chloro-2-pyridinyl)amino]benzoyl]-2-(3,4-difluoroanilino)benzoic acid |
|---|---|
| PubChem CID | 25217446 |
| Molecular Formula | C25H16ClF2N3O3 |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 5-[4-[(5-chloro-2-pyridinyl)amino]benzoyl]-2-(3,4-difluoroanilino)benzoic acid |
| SMILES | O=C(c1ccc(Nc2ccc(Cl)cn2)cc1)c1ccc(Nc2ccc(F)c(F)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H16ClF2N3O3/c26-16-4-10-23(29-13-16)31-17-5-1-14(2-6-17)24(32)15-3-9-22(19(11-15)25(33)34)30-18-7-8-20(27)21(28)12-18/h1-13,30H,(H,29,31)(H,33,34) |
| InChIKey | CELAOOSHFXEXGR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |