C26H35N5O5S2 — CID 25217513
benzyl N-[(1S)-1-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 25217513) has the molecular formula C26H35N5O5S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 25217513 |
| Molecular Formula | C26H35N5O5S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | benzyl N-[(1S)-1-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | CN(C)CCOc1ccc(-c2nc([C@H](CCCCNS(N)(=O)=O)NC(=O)OCc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C26H35N5O5S2/c1-31(2)16-17-35-22-13-11-21(12-14-22)25-29-24(19-37-25)23(10-6-7-15-28-38(27,33)34)30-26(32)36-18-20-8-4-3-5-9-20/h3-5,8-9,11-14,19,23,28H,6-7,10,15-18H2,1-2H3,(H,30,32)(H2,27,33,34)/t23-/m0/s1 |
| InChIKey | WSHXYMCKBJYERL-QHCPKHFHSA-N |
| XLogP | 3.68 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|