C21H13Cl3F3N3O2S — CID 25217589
N-(1,3-thiazol-4-ylmethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide (PubChem CID 25217589) has the molecular formula C21H13Cl3F3N3O2S and a molecular weight of 534.77 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 25217589 |
| Molecular Formula | C21H13Cl3F3N3O2S |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
| SMILES | O=C(NCc1cscn1)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C21H13Cl3F3N3O2S/c22-15-5-13(6-16(23)18(15)24)20(21(25,26)27)7-17(30-32-20)11-1-3-12(4-2-11)19(31)28-8-14-9-33-10-29-14/h1-6,9-10H,7-8H2,(H,28,31) |
| InChIKey | UFOCNDIWUDRWHA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|