About N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide
N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide (PubChem CID 2521776) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide |
| PubChem CID | 2521776 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N2O3/c22-19(8-6-14-11-20-16-4-2-1-3-15(14)16)21-10-13-5-7-17-18(9-13)24-12-23-17/h1-5,7,9,11,20H,6,8,10,12H2,(H,21,22) |
| InChIKey | ZIAHNMOJZXKEQF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide?
The IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide (CID 2521776) is N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide?
The canonical SMILES for N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide is O=C(CCc1c[nH]c2ccccc12)NCc1ccc2c(c1)OCO2.
What is the InChIKey of N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide?
The InChIKey is ZIAHNMOJZXKEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c22-19(8-6-14-11-20-16-4-2-1-3-15(14)16)21-10-13-5-7-17-18(9-13)24-12-23-17/h1-5,7,9,11,20H,6,8,10,12H2,(H,21,22).
What are the key properties of N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide?
N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide has a molecular weight of 322.36 g/mol, XLogP of 3.15, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide is sourced from PubChem (CID 2521776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).